C23H22N4OS — CID 24733554
(1-methylpyrrol-2-yl)-[4-(8-thiophen-3-ylquinolin-2-yl)piperazin-1-yl]methanone (PubChem CID 24733554) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is (1-methylpyrrol-2-yl)-[4-(8-thiophen-3-ylquinolin-2-yl)piperazin-1-yl]methanone.
| Compound Name | (1-methylpyrrol-2-yl)-[4-(8-thiophen-3-ylquinolin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 24733554 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (1-methylpyrrol-2-yl)-[4-(8-thiophen-3-ylquinolin-2-yl)piperazin-1-yl]methanone |
| SMILES | Cn1cccc1C(=O)N1CCN(c2ccc3cccc(-c4ccsc4)c3n2)CC1 |
| InChI | InChI=1S/C23H22N4OS/c1-25-10-3-6-20(25)23(28)27-13-11-26(12-14-27)21-8-7-17-4-2-5-19(22(17)24-21)18-9-15-29-16-18/h2-10,15-16H,11-14H2,1H3 |
| InChIKey | AWTYVBYDZBUDOL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |