C24H25FN4O3 — CID 24733632
ethyl 2-[[4-[8-(2-fluorophenyl)quinolin-2-yl]piperazine-1-carbonyl]amino]acetate (PubChem CID 24733632) has the molecular formula C24H25FN4O3 and a molecular weight of 436.49 g/mol. Its IUPAC name is ethyl 2-[[4-[8-(2-fluorophenyl)quinolin-2-yl]piperazine-1-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[4-[8-(2-fluorophenyl)quinolin-2-yl]piperazine-1-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 24733632 |
| Molecular Formula | C24H25FN4O3 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | ethyl 2-[[4-[8-(2-fluorophenyl)quinolin-2-yl]piperazine-1-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N1CCN(c2ccc3cccc(-c4ccccc4F)c3n2)CC1 |
| InChI | InChI=1S/C24H25FN4O3/c1-2-32-22(30)16-26-24(31)29-14-12-28(13-15-29)21-11-10-17-6-5-8-19(23(17)27-21)18-7-3-4-9-20(18)25/h3-11H,2,12-16H2,1H3,(H,26,31) |
| InChIKey | NAYQQYGEVYDDKQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |