C19H22ClFN4O4 — CID 24734177
2-(3,5-dimethyl-1,2-oxazol-4-yl)-7-[2-(4-fluorophenoxy)ethyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione;hydrochloride (PubChem CID 24734177) has the molecular formula C19H22ClFN4O4 and a molecular weight of 424.86 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-7-[2-(4-fluorophenoxy)ethyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione;hydrochloride.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-7-[2-(4-fluorophenoxy)ethyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 24734177 |
| Molecular Formula | C19H22ClFN4O4 |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-7-[2-(4-fluorophenoxy)ethyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione;hydrochloride |
| SMILES | Cc1noc(C)c1N1C(=O)C2CN(CCOc3ccc(F)cc3)CCN2C1=O.Cl |
| InChI | InChI=1S/C19H21FN4O4.ClH/c1-12-17(13(2)28-21-12)24-18(25)16-11-22(7-8-23(16)19(24)26)9-10-27-15-5-3-14(20)4-6-15;/h3-6,16H,7-11H2,1-2H3;1H |
| InChIKey | VCUVDAWEGOYGHX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|