C22H26ClN5O3S — CID 24734312
2-[7-[(5-chlorothiophen-2-yl)methyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-[[3-(dimethylamino)phenyl]methyl]acetamide (PubChem CID 24734312) has the molecular formula C22H26ClN5O3S and a molecular weight of 476.00 g/mol. Its IUPAC name is 2-[7-[(5-chlorothiophen-2-yl)methyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-[[3-(dimethylamino)phenyl]methyl]acetamide.
| Compound Name | 2-[7-[(5-chlorothiophen-2-yl)methyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-[[3-(dimethylamino)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 24734312 |
| Molecular Formula | C22H26ClN5O3S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 2-[7-[(5-chlorothiophen-2-yl)methyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-[[3-(dimethylamino)phenyl]methyl]acetamide |
| SMILES | CN(C)c1cccc(CNC(=O)CN2C(=O)C3CN(Cc4ccc(Cl)s4)CCN3C2=O)c1 |
| InChI | InChI=1S/C22H26ClN5O3S/c1-25(2)16-5-3-4-15(10-16)11-24-20(29)14-28-21(30)18-13-26(8-9-27(18)22(28)31)12-17-6-7-19(23)32-17/h3-7,10,18H,8-9,11-14H2,1-2H3,(H,24,29) |
| InChIKey | HKCDWHDNNFEMHC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|