C21H24N4O6S — CID 24734269
2-[7-(furan-2-ylmethyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-[(3-methylsulfonylphenyl)methyl]acetamide (PubChem CID 24734269) has the molecular formula C21H24N4O6S and a molecular weight of 460.51 g/mol. Its IUPAC name is 2-[7-(furan-2-ylmethyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-[(3-methylsulfonylphenyl)methyl]acetamide.
| Compound Name | 2-[7-(furan-2-ylmethyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-[(3-methylsulfonylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 24734269 |
| Molecular Formula | C21H24N4O6S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-[7-(furan-2-ylmethyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-[(3-methylsulfonylphenyl)methyl]acetamide |
| SMILES | CS(=O)(=O)c1cccc(CNC(=O)CN2C(=O)C3CN(Cc4ccco4)CCN3C2=O)c1 |
| InChI | InChI=1S/C21H24N4O6S/c1-32(29,30)17-6-2-4-15(10-17)11-22-19(26)14-25-20(27)18-13-23(7-8-24(18)21(25)28)12-16-5-3-9-31-16/h2-6,9-10,18H,7-8,11-14H2,1H3,(H,22,26) |
| InChIKey | BWTOJHPOXWSLHY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|