C22H21N3O6 — CID 24735090
methyl 3-[7-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]benzoate (PubChem CID 24735090) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is methyl 3-[7-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]benzoate.
| Compound Name | methyl 3-[7-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]benzoate |
|---|---|
| PubChem CID | 24735090 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | methyl 3-[7-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)C3CN(Cc4ccc5c(c4)OCO5)CCN3C2=O)c1 |
| InChI | InChI=1S/C22H21N3O6/c1-29-21(27)15-3-2-4-16(10-15)25-20(26)17-12-23(7-8-24(17)22(25)28)11-14-5-6-18-19(9-14)31-13-30-18/h2-6,9-10,17H,7-8,11-13H2,1H3 |
| InChIKey | RGSPTKMDMBCCCL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|