About N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide
N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide (PubChem CID 24737912) has the molecular formula C26H31Cl2N3O2
and a molecular weight of 488.46 g/mol. Its IUPAC name is N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide.
Molecular Properties
| Compound Name | N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide |
| PubChem CID | 24737912 |
| Molecular Formula | C26H31Cl2N3O2 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NC1CCCC(C(=O)N2CCN(c3ccc(Cl)c(Cl)c3)CC2)C1 |
| InChI | InChI=1S/C26H31Cl2N3O2/c27-23-11-10-22(18-24(23)28)30-13-15-31(16-14-30)26(33)20-7-4-8-21(17-20)29-25(32)12-9-19-5-2-1-3-6-19/h1-3,5-6,10-11,18,20-21H,4,7-9,12-17H2,(H,29,32) |
| InChIKey | KTLATZSUUWVBAD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide?
The IUPAC name of N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide (CID 24737912) is N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide.
What is the SMILES notation for N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide?
The canonical SMILES for N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide is O=C(CCc1ccccc1)NC1CCCC(C(=O)N2CCN(c3ccc(Cl)c(Cl)c3)CC2)C1.
What is the InChIKey of N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide?
The InChIKey is KTLATZSUUWVBAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31Cl2N3O2/c27-23-11-10-22(18-24(23)28)30-13-15-31(16-14-30)26(33)20-7-4-8-21(17-20)29-25(32)12-9-19-5-2-1-3-6-19/h1-3,5-6,10-11,18,20-21H,4,7-9,12-17H2,(H,29,32).
What are the key properties of N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide?
N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide has a molecular weight of 488.46 g/mol, XLogP of 4.95, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]cyclohexyl]-3-phenylpropanamide is sourced from PubChem (CID 24737912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).