C18H13ClN2O6S-2 — CID 2473981
5-[[(1R)-1-carboxylato-2-(1H-indol-3-yl)ethyl]sulfamoyl]-2-chlorobenzoate (PubChem CID 2473981) has the molecular formula C18H13ClN2O6S-2 and a molecular weight of 420.83 g/mol. Its IUPAC name is 5-[[(1R)-1-carboxylato-2-(1H-indol-3-yl)ethyl]sulfamoyl]-2-chlorobenzoate.
| Compound Name | 5-[[(1R)-1-carboxylato-2-(1H-indol-3-yl)ethyl]sulfamoyl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 2473981 |
| Molecular Formula | C18H13ClN2O6S-2 |
| Molecular Weight | 420.83 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 5-[[(1R)-1-carboxylato-2-(1H-indol-3-yl)ethyl]sulfamoyl]-2-chlorobenzoate |
| SMILES | O=C([O-])c1cc(S(=O)(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)[O-])ccc1Cl |
| InChI | InChI=1S/C18H15ClN2O6S/c19-14-6-5-11(8-13(14)17(22)23)28(26,27)21-16(18(24)25)7-10-9-20-15-4-2-1-3-12(10)15/h1-6,8-9,16,20-21H,7H2,(H,22,23)(H,24,25)/p-2/t16-/m1/s1 |
| InChIKey | RKVYLJOHFQPBHQ-MRXNPFEDSA-L |
| XLogP | -0.18 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.83 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |