C19H16ClN7OS — CID 24740293
1-[3-(benzotriazol-1-ylmethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-chloro-4-(3-methylphenyl)azetidin-2-one (PubChem CID 24740293) has the molecular formula C19H16ClN7OS and a molecular weight of 425.91 g/mol. Its IUPAC name is 1-[3-(benzotriazol-1-ylmethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-chloro-4-(3-methylphenyl)azetidin-2-one.
| Compound Name | 1-[3-(benzotriazol-1-ylmethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-chloro-4-(3-methylphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 24740293 |
| Molecular Formula | C19H16ClN7OS |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 1-[3-(benzotriazol-1-ylmethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-chloro-4-(3-methylphenyl)azetidin-2-one |
| SMILES | Cc1cccc(C2C(Cl)C(=O)N2n2c(Cn3nnc4ccccc43)n[nH]c2=S)c1 |
| InChI | InChI=1S/C19H16ClN7OS/c1-11-5-4-6-12(9-11)17-16(20)18(28)27(17)26-15(22-23-19(26)29)10-25-14-8-3-2-7-13(14)21-24-25/h2-9,16-17H,10H2,1H3,(H,23,29) |
| InChIKey | YBMQBFHGQCMGHZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|