C25H20ClN5O2S — CID 71594339
1-[3-(carbazol-9-ylmethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-chloro-4-(3-methoxyphenyl)azetidin-2-one (PubChem CID 71594339) has the molecular formula C25H20ClN5O2S and a molecular weight of 489.99 g/mol. Its IUPAC name is 1-[3-(carbazol-9-ylmethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-chloro-4-(3-methoxyphenyl)azetidin-2-one.
| Compound Name | 1-[3-(carbazol-9-ylmethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-chloro-4-(3-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 71594339 |
| Molecular Formula | C25H20ClN5O2S |
| Molecular Weight | 489.99 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 1-[3-(carbazol-9-ylmethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-chloro-4-(3-methoxyphenyl)azetidin-2-one |
| SMILES | COc1cccc(C2C(Cl)C(=O)N2n2c(Cn3c4ccccc4c4ccccc43)n[nH]c2=S)c1 |
| InChI | InChI=1S/C25H20ClN5O2S/c1-33-16-8-6-7-15(13-16)23-22(26)24(32)31(23)30-21(27-28-25(30)34)14-29-19-11-4-2-9-17(19)18-10-3-5-12-20(18)29/h2-13,22-23H,14H2,1H3,(H,28,34) |
| InChIKey | WSNVDZBLTWXLPB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.99 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|