C15H11ClN6S — CID 57343408
3-(benzotriazol-1-ylmethyl)-4-(3-chlorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 57343408) has the molecular formula C15H11ClN6S and a molecular weight of 342.82 g/mol. Its IUPAC name is 3-(benzotriazol-1-ylmethyl)-4-(3-chlorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(benzotriazol-1-ylmethyl)-4-(3-chlorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 57343408 |
| Molecular Formula | C15H11ClN6S |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 3-(benzotriazol-1-ylmethyl)-4-(3-chlorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(Cn2nnc3ccccc32)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H11ClN6S/c16-10-4-3-5-11(8-10)22-14(18-19-15(22)23)9-21-13-7-2-1-6-12(13)17-20-21/h1-8H,9H2,(H,19,23) |
| InChIKey | UWYNWIGJEWWVIJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|