C23H17ClN6OS — CID 4752705
2-[3-(benzotriazol-1-ylmethyl)-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]-1-(4-chlorophenyl)ethanone (PubChem CID 4752705) has the molecular formula C23H17ClN6OS and a molecular weight of 460.95 g/mol. Its IUPAC name is 2-[3-(benzotriazol-1-ylmethyl)-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]-1-(4-chlorophenyl)ethanone.
| Compound Name | 2-[3-(benzotriazol-1-ylmethyl)-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]-1-(4-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 4752705 |
| Molecular Formula | C23H17ClN6OS |
| Molecular Weight | 460.95 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 2-[3-(benzotriazol-1-ylmethyl)-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]-1-(4-chlorophenyl)ethanone |
| SMILES | O=C(Cn1nc(Cn2nnc3ccccc32)n(-c2ccccc2)c1=S)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17ClN6OS/c24-17-12-10-16(11-13-17)21(31)14-29-23(32)30(18-6-2-1-3-7-18)22(26-29)15-28-20-9-5-4-8-19(20)25-27-28/h1-13H,14-15H2 |
| InChIKey | ZCEWMVCLCYBPJD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 70.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.95 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|