C21H20ClN7OS — CID 4752433
2-[3-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]-N-(3-chloro-2-methylphenyl)acetamide (PubChem CID 4752433) has the molecular formula C21H20ClN7OS and a molecular weight of 453.96 g/mol. Its IUPAC name is 2-[3-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]-N-(3-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[3-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]-N-(3-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4752433 |
| Molecular Formula | C21H20ClN7OS |
| Molecular Weight | 453.96 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-[3-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]-N-(3-chloro-2-methylphenyl)acetamide |
| SMILES | C=CCn1c(Cn2nnc3ccccc32)nn(CC(=O)Nc2cccc(Cl)c2C)c1=S |
| InChI | InChI=1S/C21H20ClN7OS/c1-3-11-27-19(12-28-18-10-5-4-8-17(18)24-26-28)25-29(21(27)31)13-20(30)23-16-9-6-7-15(22)14(16)2/h3-10H,1,11-13H2,2H3,(H,23,30) |
| InChIKey | KFCPYQLYVHJSSK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 82.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.96 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|