C21H21Cl2N5OS — CID 4752272
2-[3-[(3-chloroanilino)methyl]-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]-N-(3-chloro-2-methylphenyl)acetamide (PubChem CID 4752272) has the molecular formula C21H21Cl2N5OS and a molecular weight of 462.41 g/mol. Its IUPAC name is 2-[3-[(3-chloroanilino)methyl]-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]-N-(3-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[3-[(3-chloroanilino)methyl]-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]-N-(3-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4752272 |
| Molecular Formula | C21H21Cl2N5OS |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 2-[3-[(3-chloroanilino)methyl]-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]-N-(3-chloro-2-methylphenyl)acetamide |
| SMILES | C=CCn1c(CNc2cccc(Cl)c2)nn(CC(=O)Nc2cccc(Cl)c2C)c1=S |
| InChI | InChI=1S/C21H21Cl2N5OS/c1-3-10-27-19(12-24-16-7-4-6-15(22)11-16)26-28(21(27)30)13-20(29)25-18-9-5-8-17(23)14(18)2/h3-9,11,24H,1,10,12-13H2,2H3,(H,25,29) |
| InChIKey | MIHJZWDSRMDFAE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|