C23H26N4OS2 — CID 4752415
N-(2,6-dimethylphenyl)-2-[3-[(4-methylphenyl)sulfanylmethyl]-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide (PubChem CID 4752415) has the molecular formula C23H26N4OS2 and a molecular weight of 438.62 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[3-[(4-methylphenyl)sulfanylmethyl]-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[3-[(4-methylphenyl)sulfanylmethyl]-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 4752415 |
| Molecular Formula | C23H26N4OS2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[3-[(4-methylphenyl)sulfanylmethyl]-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide |
| SMILES | C=CCn1c(CSc2ccc(C)cc2)nn(CC(=O)Nc2c(C)cccc2C)c1=S |
| InChI | InChI=1S/C23H26N4OS2/c1-5-13-26-20(15-30-19-11-9-16(2)10-12-19)25-27(23(26)29)14-21(28)24-22-17(3)7-6-8-18(22)4/h5-12H,1,13-15H2,2-4H3,(H,24,28) |
| InChIKey | OTCJWQWOFCLWND-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|