C21H19ClF3N5OS — CID 4752274
2-[3-[(3-chloroanilino)methyl]-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 4752274) has the molecular formula C21H19ClF3N5OS and a molecular weight of 481.93 g/mol. Its IUPAC name is 2-[3-[(3-chloroanilino)methyl]-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[3-[(3-chloroanilino)methyl]-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4752274 |
| Molecular Formula | C21H19ClF3N5OS |
| Molecular Weight | 481.93 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 2-[3-[(3-chloroanilino)methyl]-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | C=CCn1c(CNc2cccc(Cl)c2)nn(CC(=O)Nc2ccccc2C(F)(F)F)c1=S |
| InChI | InChI=1S/C21H19ClF3N5OS/c1-2-10-29-18(12-26-15-7-5-6-14(22)11-15)28-30(20(29)32)13-19(31)27-17-9-4-3-8-16(17)21(23,24)25/h2-9,11,26H,1,10,12-13H2,(H,27,31) |
| InChIKey | LOWQYDRVRMWFGD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.93 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|