C23H18BrClN4OS — CID 4752256
1-(4-bromophenyl)-2-[3-[(3-chloroanilino)methyl]-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]ethanone (PubChem CID 4752256) has the molecular formula C23H18BrClN4OS and a molecular weight of 513.85 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[3-[(3-chloroanilino)methyl]-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]ethanone.
| Compound Name | 1-(4-bromophenyl)-2-[3-[(3-chloroanilino)methyl]-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]ethanone |
|---|---|
| PubChem CID | 4752256 |
| Molecular Formula | C23H18BrClN4OS |
| Molecular Weight | 513.85 g/mol |
| Exact Mass | 512.01 |
| IUPAC Name | 1-(4-bromophenyl)-2-[3-[(3-chloroanilino)methyl]-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]ethanone |
| SMILES | O=C(Cn1nc(CNc2cccc(Cl)c2)n(-c2ccccc2)c1=S)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H18BrClN4OS/c24-17-11-9-16(10-12-17)21(30)15-28-23(31)29(20-7-2-1-3-8-20)22(27-28)14-26-19-6-4-5-18(25)13-19/h1-13,26H,14-15H2 |
| InChIKey | PUDHSXBTYRWCNQ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.85 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|