C20H20N8OS — CID 28694900
3-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-2-ylpropanamide (PubChem CID 28694900) has the molecular formula C20H20N8OS and a molecular weight of 420.50 g/mol. Its IUPAC name is 3-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-2-ylpropanamide.
| Compound Name | 3-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 28694900 |
| Molecular Formula | C20H20N8OS |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-2-ylpropanamide |
| SMILES | C=CCn1c(Cn2nnc3ccccc32)nnc1SCCC(=O)Nc1ccccn1 |
| InChI | InChI=1S/C20H20N8OS/c1-2-12-27-18(14-28-16-8-4-3-7-15(16)23-26-28)24-25-20(27)30-13-10-19(29)22-17-9-5-6-11-21-17/h2-9,11H,1,10,12-14H2,(H,21,22,29) |
| InChIKey | SJHBROMQNOGITB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|