C19H18N8O2S — CID 1028296
2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethylideneamino)acetamide (PubChem CID 1028296) has the molecular formula C19H18N8O2S and a molecular weight of 422.47 g/mol. Its IUPAC name is 2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethylideneamino)acetamide.
| Compound Name | 2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 1028296 |
| Molecular Formula | C19H18N8O2S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethylideneamino)acetamide |
| SMILES | C=CCn1c(Cn2nnc3ccccc32)nnc1SCC(=O)NN=Cc1ccco1 |
| InChI | InChI=1S/C19H18N8O2S/c1-2-9-26-17(12-27-16-8-4-3-7-15(16)21-25-27)22-24-19(26)30-13-18(28)23-20-11-14-6-5-10-29-14/h2-8,10-11H,1,9,12-13H2,(H,23,28) |
| InChIKey | MPZJDBPCWVNSKW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|