C26H22N6OS — CID 990349
2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-phenylphenyl)ethanone (PubChem CID 990349) has the molecular formula C26H22N6OS and a molecular weight of 466.57 g/mol. Its IUPAC name is 2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-phenylphenyl)ethanone.
| Compound Name | 2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 990349 |
| Molecular Formula | C26H22N6OS |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-phenylphenyl)ethanone |
| SMILES | C=CCn1c(Cn2nnc3ccccc32)nnc1SCC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22N6OS/c1-2-16-31-25(17-32-23-11-7-6-10-22(23)27-30-32)28-29-26(31)34-18-24(33)21-14-12-20(13-15-21)19-8-4-3-5-9-19/h2-15H,1,16-18H2 |
| InChIKey | AMRXMBVUTPLZLI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|