C21H20N8O2S — CID 5434289
2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 5434289) has the molecular formula C21H20N8O2S and a molecular weight of 448.51 g/mol. Its IUPAC name is 2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5434289 |
| Molecular Formula | C21H20N8O2S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | C=CCn1c(Cn2nnc3ccccc32)nnc1SCC(=O)N/N=C\c1cccc(O)c1 |
| InChI | InChI=1S/C21H20N8O2S/c1-2-10-28-19(13-29-18-9-4-3-8-17(18)23-27-29)24-26-21(28)32-14-20(31)25-22-12-15-6-5-7-16(30)11-15/h2-9,11-12,30H,1,10,13-14H2,(H,25,31)/b22-12- |
| InChIKey | UYVDVOIYTHLIHG-UUYOSTAYSA-N |
| XLogP | 2.21 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|