C21H19BrN8O2S — CID 136670430
2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 136670430) has the molecular formula C21H19BrN8O2S and a molecular weight of 527.41 g/mol. Its IUPAC name is 2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136670430 |
| Molecular Formula | C21H19BrN8O2S |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | 2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | C=CCn1c(Cn2nnc3ccccc32)nnc1SCC(=O)N/N=C\c1cc(Br)ccc1O |
| InChI | InChI=1S/C21H19BrN8O2S/c1-2-9-29-19(12-30-17-6-4-3-5-16(17)24-28-30)25-27-21(29)33-13-20(32)26-23-11-14-10-15(22)7-8-18(14)31/h2-8,10-11,31H,1,9,12-13H2,(H,26,32)/b23-11- |
| InChIKey | MMHZXJLZEMHAFD-KSEXSDGBSA-N |
| XLogP | 2.97 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|