C25H19BrCl2N8O2S — CID 4065637
2-[[5-(benzotriazol-1-ylmethyl)-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-bromo-2-methoxyphenyl)methylideneamino]acetamide (PubChem CID 4065637) has the molecular formula C25H19BrCl2N8O2S and a molecular weight of 646.36 g/mol. Its IUPAC name is 2-[[5-(benzotriazol-1-ylmethyl)-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-bromo-2-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(benzotriazol-1-ylmethyl)-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-bromo-2-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4065637 |
| Molecular Formula | C25H19BrCl2N8O2S |
| Molecular Weight | 646.36 g/mol |
| Exact Mass | 643.99 |
| IUPAC Name | 2-[[5-(benzotriazol-1-ylmethyl)-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-bromo-2-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(Br)cc1C=NNC(=O)CSc1nnc(Cn2nnc3ccccc32)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H19BrCl2N8O2S/c1-38-22-9-6-16(26)10-15(22)12-29-32-24(37)14-39-25-33-31-23(36(25)20-8-7-17(27)11-18(20)28)13-35-21-5-3-2-4-19(21)30-34-35/h2-12H,13-14H2,1H3,(H,32,37) |
| InChIKey | YLTRJFHUGVSLFJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|