C15H11N3O2 — CID 24741760
10-ethyl-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,10,15-hexaene-8,12-dione (PubChem CID 24741760) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is 10-ethyl-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,10,15-hexaene-8,12-dione.
| Compound Name | 10-ethyl-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,10,15-hexaene-8,12-dione |
|---|---|
| PubChem CID | 24741760 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 10-ethyl-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,10,15-hexaene-8,12-dione |
| SMILES | CCc1c2c(nc3[nH][nH]c(=O)c13)-c1ccccc1C2=O |
| InChI | InChI=1S/C15H11N3O2/c1-2-7-10-12(16-14-11(7)15(20)18-17-14)8-5-3-4-6-9(8)13(10)19/h3-6H,2H2,1H3,(H2,16,17,18,20) |
| InChIKey | LAYONDXFVRDVCA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|