C25H23Cl2N3O — CID 24743398
2,3-bis(4-chlorophenyl)-N-pentylimidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 24743398) has the molecular formula C25H23Cl2N3O and a molecular weight of 452.39 g/mol. Its IUPAC name is 2,3-bis(4-chlorophenyl)-N-pentylimidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 2,3-bis(4-chlorophenyl)-N-pentylimidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 24743398 |
| Molecular Formula | C25H23Cl2N3O |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 2,3-bis(4-chlorophenyl)-N-pentylimidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CCCCCNC(=O)c1ccc2nc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)n2c1 |
| InChI | InChI=1S/C25H23Cl2N3O/c1-2-3-4-15-28-25(31)19-9-14-22-29-23(17-5-10-20(26)11-6-17)24(30(22)16-19)18-7-12-21(27)13-8-18/h5-14,16H,2-4,15H2,1H3,(H,28,31) |
| InChIKey | YMMLRGZWUFYEMG-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|