C25H24Cl2N4O — CID 24992232
2,3-bis(4-chlorophenyl)-7-methyl-N-pentylimidazo[1,2-a]pyrimidine-6-carboxamide (PubChem CID 24992232) has the molecular formula C25H24Cl2N4O and a molecular weight of 467.40 g/mol. Its IUPAC name is 2,3-bis(4-chlorophenyl)-7-methyl-N-pentylimidazo[1,2-a]pyrimidine-6-carboxamide.
| Compound Name | 2,3-bis(4-chlorophenyl)-7-methyl-N-pentylimidazo[1,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 24992232 |
| Molecular Formula | C25H24Cl2N4O |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 2,3-bis(4-chlorophenyl)-7-methyl-N-pentylimidazo[1,2-a]pyrimidine-6-carboxamide |
| SMILES | CCCCCNC(=O)c1cn2c(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)nc2nc1C |
| InChI | InChI=1S/C25H24Cl2N4O/c1-3-4-5-14-28-24(32)21-15-31-23(18-8-12-20(27)13-9-18)22(30-25(31)29-16(21)2)17-6-10-19(26)11-7-17/h6-13,15H,3-5,14H2,1-2H3,(H,28,32) |
| InChIKey | JTXKTOAHBBLBHM-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|