C29H33Cl2FN2OS — CID 24744004
(3S)-1-[4-(2-chloro-4-methoxy-5-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-8-cyclopropyl-4-(4-fluorophenyl)oct-1-yn-3-amine;hydrochloride (PubChem CID 24744004) has the molecular formula C29H33Cl2FN2OS and a molecular weight of 547.57 g/mol. Its IUPAC name is (3S)-1-[4-(2-chloro-4-methoxy-5-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-8-cyclopropyl-4-(4-fluorophenyl)oct-1-yn-3-amine;hydrochloride.
| Compound Name | (3S)-1-[4-(2-chloro-4-methoxy-5-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-8-cyclopropyl-4-(4-fluorophenyl)oct-1-yn-3-amine;hydrochloride |
|---|---|
| PubChem CID | 24744004 |
| Molecular Formula | C29H33Cl2FN2OS |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | (3S)-1-[4-(2-chloro-4-methoxy-5-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-8-cyclopropyl-4-(4-fluorophenyl)oct-1-yn-3-amine;hydrochloride |
| SMILES | COc1cc(Cl)c(-c2nc(C#C[C@@H](N)C(CCCCC3CC3)c3ccc(F)cc3)sc2C)cc1C.Cl |
| InChI | InChI=1S/C29H32ClFN2OS.ClH/c1-18-16-24(25(30)17-27(18)34-3)29-19(2)35-28(33-29)15-14-26(32)23(7-5-4-6-20-8-9-20)21-10-12-22(31)13-11-21;/h10-13,16-17,20,23,26H,4-9,32H2,1-3H3;1H/t23?,26-;/m1./s1 |
| InChIKey | YKFQZVLAIPDRPS-LEPAHFLUSA-N |
| XLogP | 8.08 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|