C22H35NO5SSi — CID 24749230
(6S,7R,7aS)-6-(benzenesulfonyl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 24749230) has the molecular formula C22H35NO5SSi and a molecular weight of 453.68 g/mol. Its IUPAC name is (6S,7R,7aS)-6-(benzenesulfonyl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (6S,7R,7aS)-6-(benzenesulfonyl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 24749230 |
| Molecular Formula | C22H35NO5SSi |
| Molecular Weight | 453.68 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | (6S,7R,7aS)-6-(benzenesulfonyl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC1(C)OC[C@@H]2[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@H](S(=O)(=O)c3ccccc3)C(=O)N21 |
| InChI | InChI=1S/C22H35NO5SSi/c1-21(2,3)30(6,7)28-14-13-17-18-15-27-22(4,5)23(18)20(24)19(17)29(25,26)16-11-9-8-10-12-16/h8-12,17-19H,13-15H2,1-7H3/t17-,18-,19+/m1/s1 |
| InChIKey | BYAGVAANQORHOQ-QRVBRYPASA-N |
| XLogP | 3.83 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.68 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|