C25H36F3NO8S2Si — CID 24750656
1-[(6R,7R,7aS)-6-(benzenesulfonyl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-5-oxo-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl]ethenyl trifluoromethanesulfonate (PubChem CID 24750656) has the molecular formula C25H36F3NO8S2Si and a molecular weight of 627.78 g/mol. Its IUPAC name is 1-[(6R,7R,7aS)-6-(benzenesulfonyl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-5-oxo-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl]ethenyl trifluoromethanesulfonate.
| Compound Name | 1-[(6R,7R,7aS)-6-(benzenesulfonyl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-5-oxo-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl]ethenyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 24750656 |
| Molecular Formula | C25H36F3NO8S2Si |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.16 |
| IUPAC Name | 1-[(6R,7R,7aS)-6-(benzenesulfonyl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-5-oxo-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl]ethenyl trifluoromethanesulfonate |
| SMILES | C=C(OS(=O)(=O)C(F)(F)F)[C@@]1(S(=O)(=O)c2ccccc2)C(=O)N2[C@H](COC2(C)C)[C@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H36F3NO8S2Si/c1-17(37-39(33,34)25(26,27)28)24(38(31,32)18-12-10-9-11-13-18)19(14-15-36-40(7,8)22(2,3)4)20-16-35-23(5,6)29(20)21(24)30/h9-13,19-20H,1,14-16H2,2-8H3/t19-,20-,24+/m1/s1 |
| InChIKey | GBOUHDXKXSWSGQ-REHUZNOOSA-N |
| XLogP | 4.58 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|