C20H31NO5SSi — CID 10938821
(6R,7S,7aS)-6-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 10938821) has the molecular formula C20H31NO5SSi and a molecular weight of 425.62 g/mol. Its IUPAC name is (6R,7S,7aS)-6-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (6R,7S,7aS)-6-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 10938821 |
| Molecular Formula | C20H31NO5SSi |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (6R,7S,7aS)-6-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC1(C)OC[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](S(=O)(=O)c3ccccc3)C(=O)N21 |
| InChI | InChI=1S/C20H31NO5SSi/c1-19(2,3)28(6,7)26-16-15-13-25-20(4,5)21(15)18(22)17(16)27(23,24)14-11-9-8-10-12-14/h8-12,15-17H,13H2,1-7H3/t15-,16-,17+/m0/s1 |
| InChIKey | JTLIONHDQROWIG-YESZJQIVSA-N |
| XLogP | 3.20 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|