C21H33NO5SSi — CID 11015666
(1R,6R,7S,7aS)-6-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 11015666) has the molecular formula C21H33NO5SSi and a molecular weight of 439.65 g/mol. Its IUPAC name is (1R,6R,7S,7aS)-6-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (1R,6R,7S,7aS)-6-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 11015666 |
| Molecular Formula | C21H33NO5SSi |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (1R,6R,7S,7aS)-6-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C[C@H]1OC(C)(C)N2C(=O)[C@H](S(=O)(=O)c3ccccc3)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]12 |
| InChI | InChI=1S/C21H33NO5SSi/c1-14-16-17(27-29(7,8)20(2,3)4)18(19(23)22(16)21(5,6)26-14)28(24,25)15-12-10-9-11-13-15/h9-14,16-18H,1-8H3/t14-,16+,17+,18-/m1/s1 |
| InChIKey | MNWNNARJHCFWCU-LAVFITLUSA-N |
| XLogP | 3.58 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|