C21H44O5Si2 — CID 24749922
methyl (E,4R,5R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4-methylhex-2-enoate (PubChem CID 24749922) has the molecular formula C21H44O5Si2 and a molecular weight of 432.75 g/mol. Its IUPAC name is methyl (E,4R,5R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4-methylhex-2-enoate.
| Compound Name | methyl (E,4R,5R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4-methylhex-2-enoate |
|---|---|
| PubChem CID | 24749922 |
| Molecular Formula | C21H44O5Si2 |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | methyl (E,4R,5R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4-methylhex-2-enoate |
| SMILES | COC(=O)/C=C(/OC)[C@H](C)[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O5Si2/c1-16(17(23-8)14-19(22)24-9)18(26-28(12,13)21(5,6)7)15-25-27(10,11)20(2,3)4/h14,16,18H,15H2,1-13H3/b17-14+/t16-,18-/m0/s1 |
| InChIKey | FIJIFEFPBSNXSY-RMFBKJGXSA-N |
| XLogP | 5.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|