C24H32N6O2 — CID 24750165
8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-(2-phenylethyl)purine-2,6-dione (PubChem CID 24750165) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-(2-phenylethyl)purine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-(2-phenylethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 24750165 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-(2-phenylethyl)purine-2,6-dione |
| SMILES | CC(C)=CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(CCc1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C24H32N6O2/c1-17(2)11-14-29-20-21(26-23(29)28-13-7-10-19(25)16-28)27(3)24(32)30(22(20)31)15-12-18-8-5-4-6-9-18/h4-6,8-9,11,19H,7,10,12-16,25H2,1-3H3 |
| InChIKey | PKKUANXEDPALTC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|