C18H19N3O2S — CID 24752182
3-(benzenesulfonyl)-7-piperidin-1-yl-2H-indazole (PubChem CID 24752182) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-7-piperidin-1-yl-2H-indazole.
| Compound Name | 3-(benzenesulfonyl)-7-piperidin-1-yl-2H-indazole |
|---|---|
| PubChem CID | 24752182 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 3-(benzenesulfonyl)-7-piperidin-1-yl-2H-indazole |
| SMILES | O=S(=O)(c1ccccc1)c1[nH]nc2c(N3CCCCC3)cccc12 |
| InChI | InChI=1S/C18H19N3O2S/c22-24(23,14-8-3-1-4-9-14)18-15-10-7-11-16(17(15)19-20-18)21-12-5-2-6-13-21/h1,3-4,7-11H,2,5-6,12-13H2,(H,19,20) |
| InChIKey | WZHVMNPYOBKWQD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |