C15H16ClN3O2S — CID 68681490
2-[3-(benzenesulfonyl)-2H-indazol-7-yl]ethanamine;hydrochloride (PubChem CID 68681490) has the molecular formula C15H16ClN3O2S and a molecular weight of 337.83 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)-2H-indazol-7-yl]ethanamine;hydrochloride.
| Compound Name | 2-[3-(benzenesulfonyl)-2H-indazol-7-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 68681490 |
| Molecular Formula | C15H16ClN3O2S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-[3-(benzenesulfonyl)-2H-indazol-7-yl]ethanamine;hydrochloride |
| SMILES | Cl.NCCc1cccc2c(S(=O)(=O)c3ccccc3)[nH]nc12 |
| InChI | InChI=1S/C15H15N3O2S.ClH/c16-10-9-11-5-4-8-13-14(11)17-18-15(13)21(19,20)12-6-2-1-3-7-12;/h1-8H,9-10,16H2,(H,17,18);1H |
| InChIKey | NWGKUQOLDFNKAD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |