C44H26N4O8S4 — CID 58835712
4,5,15,16-tetrakis(benzenesulfonyl)-3,6,14,17-tetrazahexacyclo[10.10.2.02,7.08,24.013,18.019,23]tetracosa-1(23),2(7),3,5,8(24),9,11,13(18),14,16,19,21-dodecaene (PubChem CID 58835712) has the molecular formula C44H26N4O8S4 and a molecular weight of 866.98 g/mol. Its IUPAC name is 4,5,15,16-tetrakis(benzenesulfonyl)-3,6,14,17-tetrazahexacyclo[10.10.2.02,7.08,24.013,18.019,23]tetracosa-1(23),2(7),3,5,8(24),9,11,13(18),14,16,19,21-dodecaene.
| Compound Name | 4,5,15,16-tetrakis(benzenesulfonyl)-3,6,14,17-tetrazahexacyclo[10.10.2.02,7.08,24.013,18.019,23]tetracosa-1(23),2(7),3,5,8(24),9,11,13(18),14,16,19,21-dodecaene |
|---|---|
| PubChem CID | 58835712 |
| Molecular Formula | C44H26N4O8S4 |
| Molecular Weight | 866.98 g/mol |
| Exact Mass | 866.06 |
| IUPAC Name | 4,5,15,16-tetrakis(benzenesulfonyl)-3,6,14,17-tetrazahexacyclo[10.10.2.02,7.08,24.013,18.019,23]tetracosa-1(23),2(7),3,5,8(24),9,11,13(18),14,16,19,21-dodecaene |
| SMILES | O=S(=O)(c1ccccc1)c1nc2c3cccc4c5nc(S(=O)(=O)c6ccccc6)c(S(=O)(=O)c6ccccc6)nc5c5cccc(c2nc1S(=O)(=O)c1ccccc1)c5c34 |
| InChI | InChI=1S/C44H26N4O8S4/c49-57(50,27-15-5-1-6-16-27)41-42(58(51,52)28-17-7-2-8-18-28)46-38-32-24-14-26-34-36(32)35-31(37(38)45-41)23-13-25-33(35)39-40(34)48-44(60(55,56)30-21-11-4-12-22-30)43(47-39)59(53,54)29-19-9-3-10-20-29/h1-26H |
| InChIKey | ZMJOTYOPECHCQT-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 188.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.98 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|