C36H21N6O10S5- — CID 146429692
5,10,16,17-tetrakis(benzenesulfonyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8,10,12,15,17-nonaene-4-sulfinate (PubChem CID 146429692) has the molecular formula C36H21N6O10S5- and a molecular weight of 857.93 g/mol. Its IUPAC name is 5,10,16,17-tetrakis(benzenesulfonyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8,10,12,15,17-nonaene-4-sulfinate.
| Compound Name | 5,10,16,17-tetrakis(benzenesulfonyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8,10,12,15,17-nonaene-4-sulfinate |
|---|---|
| PubChem CID | 146429692 |
| Molecular Formula | C36H21N6O10S5- |
| Molecular Weight | 857.93 g/mol |
| Exact Mass | 856.99 |
| IUPAC Name | 5,10,16,17-tetrakis(benzenesulfonyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8,10,12,15,17-nonaene-4-sulfinate |
| SMILES | O=S([O-])c1nc2c(nc1S(=O)(=O)c1ccccc1)c1nc(S(=O)(=O)c3ccccc3)cnc1c1nc(S(=O)(=O)c3ccccc3)c(S(=O)(=O)c3ccccc3)nc21 |
| InChI | InChI=1S/C36H22N6O10S5/c43-53(44)33-34(55(47,48)23-15-7-2-8-16-23)40-31-28-27(37-21-26(38-28)54(45,46)22-13-5-1-6-14-22)29-32(30(31)39-33)42-36(57(51,52)25-19-11-4-12-20-25)35(41-29)56(49,50)24-17-9-3-10-18-24/h1-21H,(H,43,44)/p-1 |
| InChIKey | RNFAEANCFFFSJG-UHFFFAOYSA-M |
| XLogP | 4.09 |
| TPSA | 254.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.93 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|