C27H30ClN5O2 — CID 24752952
N-(2-aminophenyl)-4-[2-(4-chloroanilino)-1-(4-ethylpiperazin-1-yl)-2-oxoethyl]benzamide (PubChem CID 24752952) has the molecular formula C27H30ClN5O2 and a molecular weight of 492.02 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[2-(4-chloroanilino)-1-(4-ethylpiperazin-1-yl)-2-oxoethyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[2-(4-chloroanilino)-1-(4-ethylpiperazin-1-yl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 24752952 |
| Molecular Formula | C27H30ClN5O2 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | N-(2-aminophenyl)-4-[2-(4-chloroanilino)-1-(4-ethylpiperazin-1-yl)-2-oxoethyl]benzamide |
| SMILES | CCN1CCN(C(C(=O)Nc2ccc(Cl)cc2)c2ccc(C(=O)Nc3ccccc3N)cc2)CC1 |
| InChI | InChI=1S/C27H30ClN5O2/c1-2-32-15-17-33(18-16-32)25(27(35)30-22-13-11-21(28)12-14-22)19-7-9-20(10-8-19)26(34)31-24-6-4-3-5-23(24)29/h3-14,25H,2,15-18,29H2,1H3,(H,30,35)(H,31,34) |
| InChIKey | PSKIXQJYBNQSCC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|