C32H32ClN5O2 — CID 24753122
N-(2-amino-5-phenylphenyl)-4-[2-(4-chloroanilino)-1-(4-methylpiperazin-1-yl)-2-oxoethyl]benzamide (PubChem CID 24753122) has the molecular formula C32H32ClN5O2 and a molecular weight of 554.09 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-4-[2-(4-chloroanilino)-1-(4-methylpiperazin-1-yl)-2-oxoethyl]benzamide.
| Compound Name | N-(2-amino-5-phenylphenyl)-4-[2-(4-chloroanilino)-1-(4-methylpiperazin-1-yl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 24753122 |
| Molecular Formula | C32H32ClN5O2 |
| Molecular Weight | 554.09 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-4-[2-(4-chloroanilino)-1-(4-methylpiperazin-1-yl)-2-oxoethyl]benzamide |
| SMILES | CN1CCN(C(C(=O)Nc2ccc(Cl)cc2)c2ccc(C(=O)Nc3cc(-c4ccccc4)ccc3N)cc2)CC1 |
| InChI | InChI=1S/C32H32ClN5O2/c1-37-17-19-38(20-18-37)30(32(40)35-27-14-12-26(33)13-15-27)23-7-9-24(10-8-23)31(39)36-29-21-25(11-16-28(29)34)22-5-3-2-4-6-22/h2-16,21,30H,17-20,34H2,1H3,(H,35,40)(H,36,39) |
| InChIKey | XQKBFRXYONXNSI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.09 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|