C23H28N4O3 — CID 68776056
N-(2-aminophenyl)-4-[[3,3-dimethyl-2-(2-oxopyrrolidin-1-yl)butanoyl]amino]benzamide (PubChem CID 68776056) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[3,3-dimethyl-2-(2-oxopyrrolidin-1-yl)butanoyl]amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[3,3-dimethyl-2-(2-oxopyrrolidin-1-yl)butanoyl]amino]benzamide |
|---|---|
| PubChem CID | 68776056 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-(2-aminophenyl)-4-[[3,3-dimethyl-2-(2-oxopyrrolidin-1-yl)butanoyl]amino]benzamide |
| SMILES | CC(C)(C)C(C(=O)Nc1ccc(C(=O)Nc2ccccc2N)cc1)N1CCCC1=O |
| InChI | InChI=1S/C23H28N4O3/c1-23(2,3)20(27-14-6-9-19(27)28)22(30)25-16-12-10-15(11-13-16)21(29)26-18-8-5-4-7-17(18)24/h4-5,7-8,10-13,20H,6,9,14,24H2,1-3H3,(H,25,30)(H,26,29) |
| InChIKey | PPIXNSPXJUECFM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|