C18H34O5Si — CID 24754867
(4S,5R)-5-[(2S)-5,6-dihydroxy-2,6-dimethyl-2-trimethylsilyloxyheptyl]-4-ethenyloxolan-2-one (PubChem CID 24754867) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is (4S,5R)-5-[(2S)-5,6-dihydroxy-2,6-dimethyl-2-trimethylsilyloxyheptyl]-4-ethenyloxolan-2-one.
| Compound Name | (4S,5R)-5-[(2S)-5,6-dihydroxy-2,6-dimethyl-2-trimethylsilyloxyheptyl]-4-ethenyloxolan-2-one |
|---|---|
| PubChem CID | 24754867 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | (4S,5R)-5-[(2S)-5,6-dihydroxy-2,6-dimethyl-2-trimethylsilyloxyheptyl]-4-ethenyloxolan-2-one |
| SMILES | C=C[C@@H]1CC(=O)O[C@@H]1C[C@](C)(CCC(O)C(C)(C)O)O[Si](C)(C)C |
| InChI | InChI=1S/C18H34O5Si/c1-8-13-11-16(20)22-14(13)12-18(4,23-24(5,6)7)10-9-15(19)17(2,3)21/h8,13-15,19,21H,1,9-12H2,2-7H3/t13-,14-,15?,18+/m1/s1 |
| InChIKey | OOEHEZQXJQSWAT-CIBMZMPCSA-N |
| XLogP | 3.02 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|