C26H52O4Si — CID 10527815
tert-butyl (6R,9S,11R)-9-[diethyl(propan-2-yl)silyl]oxy-11-hydroxy-6-methyltetradec-13-enoate (PubChem CID 10527815) has the molecular formula C26H52O4Si and a molecular weight of 456.78 g/mol. Its IUPAC name is tert-butyl (6R,9S,11R)-9-[diethyl(propan-2-yl)silyl]oxy-11-hydroxy-6-methyltetradec-13-enoate.
| Compound Name | tert-butyl (6R,9S,11R)-9-[diethyl(propan-2-yl)silyl]oxy-11-hydroxy-6-methyltetradec-13-enoate |
|---|---|
| PubChem CID | 10527815 |
| Molecular Formula | C26H52O4Si |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | tert-butyl (6R,9S,11R)-9-[diethyl(propan-2-yl)silyl]oxy-11-hydroxy-6-methyltetradec-13-enoate |
| SMILES | C=CC[C@@H](O)C[C@H](CC[C@H](C)CCCCC(=O)OC(C)(C)C)O[Si](CC)(CC)C(C)C |
| InChI | InChI=1S/C26H52O4Si/c1-10-15-23(27)20-24(30-31(11-2,12-3)21(4)5)19-18-22(6)16-13-14-17-25(28)29-26(7,8)9/h10,21-24,27H,1,11-20H2,2-9H3/t22-,23-,24+/m1/s1 |
| InChIKey | KMLQXVFCSAVFAD-SMIHKQSGSA-N |
| XLogP | 7.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|