C27H54O6Si — CID 134878855
tert-butyl (3S,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3-(methoxymethoxy)-3-methyl-5-prop-2-enylundecanoate (PubChem CID 134878855) has the molecular formula C27H54O6Si and a molecular weight of 502.81 g/mol. Its IUPAC name is tert-butyl (3S,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3-(methoxymethoxy)-3-methyl-5-prop-2-enylundecanoate.
| Compound Name | tert-butyl (3S,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3-(methoxymethoxy)-3-methyl-5-prop-2-enylundecanoate |
|---|---|
| PubChem CID | 134878855 |
| Molecular Formula | C27H54O6Si |
| Molecular Weight | 502.81 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | tert-butyl (3S,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3-(methoxymethoxy)-3-methyl-5-prop-2-enylundecanoate |
| SMILES | C=CC[C@H]([C@@H](O)CCCCC)[C@H](O[Si](C)(C)C(C)(C)C)[C@](C)(CC(=O)OC(C)(C)C)OCOC |
| InChI | InChI=1S/C27H54O6Si/c1-13-15-16-18-22(28)21(17-14-2)24(33-34(11,12)26(6,7)8)27(9,31-20-30-10)19-23(29)32-25(3,4)5/h14,21-22,24,28H,2,13,15-20H2,1,3-12H3/t21-,22+,24+,27+/m1/s1 |
| InChIKey | ZTMHWKQCBKUAPO-QRSXMVCTSA-N |
| XLogP | 6.62 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.81 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|