C16H30O4Si — CID 11515180
(4S,5S)-5-[(2R,3S)-2-hydroxy-3-methylpent-4-enyl]-4-triethylsilyloxyoxolan-2-one (PubChem CID 11515180) has the molecular formula C16H30O4Si and a molecular weight of 314.50 g/mol. Its IUPAC name is (4S,5S)-5-[(2R,3S)-2-hydroxy-3-methylpent-4-enyl]-4-triethylsilyloxyoxolan-2-one.
| Compound Name | (4S,5S)-5-[(2R,3S)-2-hydroxy-3-methylpent-4-enyl]-4-triethylsilyloxyoxolan-2-one |
|---|---|
| PubChem CID | 11515180 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (4S,5S)-5-[(2R,3S)-2-hydroxy-3-methylpent-4-enyl]-4-triethylsilyloxyoxolan-2-one |
| SMILES | C=C[C@H](C)[C@H](O)C[C@@H]1OC(=O)C[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H30O4Si/c1-6-12(5)13(17)10-14-15(11-16(18)19-14)20-21(7-2,8-3)9-4/h6,12-15,17H,1,7-11H2,2-5H3/t12-,13+,14-,15-/m0/s1 |
| InChIKey | AKGNWXNKZSGUSJ-XGUBFFRZSA-N |
| XLogP | 3.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|