C24H26ClNO3S — CID 24759407
(1R,4R,7R,8R,11R)-8-(4-chlorophenyl)-3,3-dimethyl-11-phenyl-4-propan-2-yl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one (PubChem CID 24759407) has the molecular formula C24H26ClNO3S and a molecular weight of 444.00 g/mol. Its IUPAC name is (1R,4R,7R,8R,11R)-8-(4-chlorophenyl)-3,3-dimethyl-11-phenyl-4-propan-2-yl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one.
| Compound Name | (1R,4R,7R,8R,11R)-8-(4-chlorophenyl)-3,3-dimethyl-11-phenyl-4-propan-2-yl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
|---|---|
| PubChem CID | 24759407 |
| Molecular Formula | C24H26ClNO3S |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | (1R,4R,7R,8R,11R)-8-(4-chlorophenyl)-3,3-dimethyl-11-phenyl-4-propan-2-yl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
| SMILES | CC(C)[C@H]1N2C(=O)[C@H]3[C@H](c4ccc(Cl)cc4)O[C@]2(OC1(C)C)S[C@H]3c1ccccc1 |
| InChI | InChI=1S/C24H26ClNO3S/c1-14(2)21-23(3,4)29-24-26(21)22(27)18(20(30-24)16-8-6-5-7-9-16)19(28-24)15-10-12-17(25)13-11-15/h5-14,18-21H,1-4H3/t18-,19-,20-,21+,24+/m0/s1 |
| InChIKey | GYNSAFITUONQSX-GUJLLPCUSA-N |
| XLogP | 5.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |