C25H29NO3S — CID 24759406
(1R,4S,7S,8S,11R)-3,3-dimethyl-8-(4-methylphenyl)-11-phenyl-4-propan-2-yl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one (PubChem CID 24759406) has the molecular formula C25H29NO3S and a molecular weight of 423.58 g/mol. Its IUPAC name is (1R,4S,7S,8S,11R)-3,3-dimethyl-8-(4-methylphenyl)-11-phenyl-4-propan-2-yl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one.
| Compound Name | (1R,4S,7S,8S,11R)-3,3-dimethyl-8-(4-methylphenyl)-11-phenyl-4-propan-2-yl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
|---|---|
| PubChem CID | 24759406 |
| Molecular Formula | C25H29NO3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (1R,4S,7S,8S,11R)-3,3-dimethyl-8-(4-methylphenyl)-11-phenyl-4-propan-2-yl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
| SMILES | Cc1ccc([C@H]2O[C@@]34OC(C)(C)[C@H](C(C)C)N3C(=O)[C@H]2[C@H](c2ccccc2)S4)cc1 |
| InChI | InChI=1S/C25H29NO3S/c1-15(2)22-24(4,5)29-25-26(22)23(27)19(21(30-25)18-9-7-6-8-10-18)20(28-25)17-13-11-16(3)12-14-17/h6-15,19-22H,1-5H3/t19-,20-,21+,22+,25-/m1/s1 |
| InChIKey | OTISJFTVFBPUJA-SHNSKLSNSA-N |
| XLogP | 5.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |