C26H23NO3S — CID 101262231
(1S,3R,7R,8R,11R)-8-(4-methylphenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one (PubChem CID 101262231) has the molecular formula C26H23NO3S and a molecular weight of 429.54 g/mol. Its IUPAC name is (1S,3R,7R,8R,11R)-8-(4-methylphenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one.
| Compound Name | (1S,3R,7R,8R,11R)-8-(4-methylphenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
|---|---|
| PubChem CID | 101262231 |
| Molecular Formula | C26H23NO3S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (1S,3R,7R,8R,11R)-8-(4-methylphenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
| SMILES | Cc1ccc([C@@H]2O[C@]34O[C@H](c5ccccc5)CN3C(=O)[C@@H]2[C@H](c2ccccc2)S4)cc1 |
| InChI | InChI=1S/C26H23NO3S/c1-17-12-14-19(15-13-17)23-22-24(20-10-6-3-7-11-20)31-26(30-23)27(25(22)28)16-21(29-26)18-8-4-2-5-9-18/h2-15,21-24H,16H2,1H3/t21-,22-,23-,24-,26+/m0/s1 |
| InChIKey | ZPUMGCGMMFNCPY-MDLKPKIOSA-N |
| XLogP | 5.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |