C27H25NO3S — CID 12982610
(1R,3R,4S,7R,8R,11R)-4-methyl-8-(4-methylphenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one (PubChem CID 12982610) has the molecular formula C27H25NO3S and a molecular weight of 443.57 g/mol. Its IUPAC name is (1R,3R,4S,7R,8R,11R)-4-methyl-8-(4-methylphenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one.
| Compound Name | (1R,3R,4S,7R,8R,11R)-4-methyl-8-(4-methylphenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
|---|---|
| PubChem CID | 12982610 |
| Molecular Formula | C27H25NO3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (1R,3R,4S,7R,8R,11R)-4-methyl-8-(4-methylphenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
| SMILES | Cc1ccc([C@@H]2O[C@@]34O[C@H](c5ccccc5)[C@H](C)N3C(=O)[C@@H]2[C@H](c2ccccc2)S4)cc1 |
| InChI | InChI=1S/C27H25NO3S/c1-17-13-15-20(16-14-17)24-22-25(21-11-7-4-8-12-21)32-27(31-24)28(26(22)29)18(2)23(30-27)19-9-5-3-6-10-19/h3-16,18,22-25H,1-2H3/t18-,22-,23-,24-,25-,27-/m0/s1 |
| InChIKey | DQVOESSVLNZFTO-RWXUZHKTSA-N |
| XLogP | 5.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |