C25H20ClNO3S — CID 101262234
(1S,3R,7R,8S,11R)-8-(4-chlorophenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one (PubChem CID 101262234) has the molecular formula C25H20ClNO3S and a molecular weight of 449.96 g/mol. Its IUPAC name is (1S,3R,7R,8S,11R)-8-(4-chlorophenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one.
| Compound Name | (1S,3R,7R,8S,11R)-8-(4-chlorophenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
|---|---|
| PubChem CID | 101262234 |
| Molecular Formula | C25H20ClNO3S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | (1S,3R,7R,8S,11R)-8-(4-chlorophenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
| SMILES | O=C1[C@H]2[C@@H](c3ccc(Cl)cc3)O[C@@]3(O[C@H](c4ccccc4)CN13)S[C@H]2c1ccccc1 |
| InChI | InChI=1S/C25H20ClNO3S/c26-19-13-11-17(12-14-19)22-21-23(18-9-5-2-6-10-18)31-25(30-22)27(24(21)28)15-20(29-25)16-7-3-1-4-8-16/h1-14,20-23H,15H2/t20-,21-,22+,23-,25+/m0/s1 |
| InChIKey | XTPNBVFWKYTUHC-LYVDORBWSA-N |
| XLogP | 5.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |