C19H14N2O3 — CID 24761345
3-(furan-2-yl)-4-(6-methoxy-3-pyridinyl)-5-phenyl-1,2-oxazole (PubChem CID 24761345) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is 3-(furan-2-yl)-4-(6-methoxy-3-pyridinyl)-5-phenyl-1,2-oxazole.
| Compound Name | 3-(furan-2-yl)-4-(6-methoxy-3-pyridinyl)-5-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 24761345 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3-(furan-2-yl)-4-(6-methoxy-3-pyridinyl)-5-phenyl-1,2-oxazole |
| SMILES | COc1ccc(-c2c(-c3ccco3)noc2-c2ccccc2)cn1 |
| InChI | InChI=1S/C19H14N2O3/c1-22-16-10-9-14(12-20-16)17-18(15-8-5-11-23-15)21-24-19(17)13-6-3-2-4-7-13/h2-12H,1H3 |
| InChIKey | CLQQAUIRMBSYEU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |